About disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate
disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate (PubChem CID 172550095) has the molecular formula C15H29FNNa2O6P
and a molecular weight of 415.35 g/mol. Its IUPAC name is disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate.
Molecular Properties
| Compound Name | disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate |
| PubChem CID | 172550095 |
| Molecular Formula | C15H29FNNa2O6P |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate |
| SMILES | CCCCCCCCCCCC(=O)N(C)CC(=O)[O-].O=P([O-])(O)F.[Na+].[Na+] |
| InChI | InChI=1S/C15H29NO3.FH2O3P.2Na/c1-3-4-5-6-7-8-9-10-11-12-14(17)16(2)13-15(18)19;1-5(2,3)4;;/h3-13H2,1-2H3,(H,18,19);(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | FJECRZKPGRFMMV-UHFFFAOYSA-L |
| XLogP | -4.46 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate?
The IUPAC name of disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate (CID 172550095) is disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate.
What is the SMILES notation for disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate?
The canonical SMILES for disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate is CCCCCCCCCCCC(=O)N(C)CC(=O)[O-].O=P([O-])(O)F.[Na+].[Na+].
What is the InChIKey of disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate?
The InChIKey is FJECRZKPGRFMMV-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H29NO3.FH2O3P.2Na/c1-3-4-5-6-7-8-9-10-11-12-14(17)16(2)13-15(18)19;1-5(2,3)4;;/h3-13H2,1-2H3,(H,18,19);(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate?
disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate has a molecular weight of 415.35 g/mol, XLogP of -4.46, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[dodecanoyl(methyl)amino]acetate;fluoro(hydroxy)phosphinate is sourced from PubChem (CID 172550095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).