1,3-dibutylbenzotriazol-3-ium bromide

C14H22BrN3 — CID 15639330

IUPAC1,3-dibutylbenzotriazol-3-ium bromide
SMILESCCCCn1n[n+](CCCC)c2ccccc21.[Br-]
InChIInChI=1S/C14H22N3.BrH/c1-3-5-11-16-13-9-7-8-10-14(13)17(15-16)12-6-4-2;/h7-10H,3-6,11-12H2,1-2H3;1H/q+1;/p-1
InChIKeyDPQLWBZAWUYOAQ-UHFFFAOYSA-M
MW312.25 g/mol
LogP-0.07
Rot. Bonds6

About 1,3-dibutylbenzotriazol-3-ium bromide

1,3-dibutylbenzotriazol-3-ium bromide (PubChem CID 15639330) has the molecular formula C14H22BrN3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 1,3-dibutylbenzotriazol-3-ium bromide.

Molecular Properties

Compound Name1,3-dibutylbenzotriazol-3-ium bromide
PubChem CID15639330
Molecular FormulaC14H22BrN3
Molecular Weight312.25 g/mol
Exact Mass311.10
IUPAC Name1,3-dibutylbenzotriazol-3-ium bromide
SMILESCCCCn1n[n+](CCCC)c2ccccc21.[Br-]
InChIInChI=1S/C14H22N3.BrH/c1-3-5-11-16-13-9-7-8-10-14(13)17(15-16)12-6-4-2;/h7-10H,3-6,11-12H2,1-2H3;1H/q+1;/p-1
InChIKeyDPQLWBZAWUYOAQ-UHFFFAOYSA-M
XLogP-0.07
TPSA21.70 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.25
LogP ≤ 5-0.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 1,3-dibutylbenzotriazol-3-ium bromide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dibutylbenzotriazol-3-ium bromide?
The IUPAC name of 1,3-dibutylbenzotriazol-3-ium bromide (CID 15639330) is 1,3-dibutylbenzotriazol-3-ium bromide.
What is the SMILES notation for 1,3-dibutylbenzotriazol-3-ium bromide?
The canonical SMILES for 1,3-dibutylbenzotriazol-3-ium bromide is CCCCn1n[n+](CCCC)c2ccccc21.[Br-].
What is the InChIKey of 1,3-dibutylbenzotriazol-3-ium bromide?
The InChIKey is DPQLWBZAWUYOAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22N3.BrH/c1-3-5-11-16-13-9-7-8-10-14(13)17(15-16)12-6-4-2;/h7-10H,3-6,11-12H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1,3-dibutylbenzotriazol-3-ium bromide?
1,3-dibutylbenzotriazol-3-ium bromide has a molecular weight of 312.25 g/mol, XLogP of -0.07, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutylbenzotriazol-3-ium bromide is sourced from PubChem (CID 15639330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).