C6H12O3 — CID 15644986
(2R,3S)-3-hydroperoxy-4-methylpent-4-en-2-ol (PubChem CID 15644986) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R,3S)-3-hydroperoxy-4-methylpent-4-en-2-ol.
| Compound Name | (2R,3S)-3-hydroperoxy-4-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 15644986 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (2R,3S)-3-hydroperoxy-4-methylpent-4-en-2-ol |
| SMILES | C=C(C)[C@H](OO)[C@@H](C)O |
| InChI | InChI=1S/C6H12O3/c1-4(2)6(9-8)5(3)7/h5-8H,1H2,2-3H3/t5-,6+/m1/s1 |
| InChIKey | XFXUOLOFWHNLKJ-RITPCOANSA-N |
| XLogP | 0.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|