C11H20OSi — CID 15649762
2-[(2R,3R)-3-butyloxiran-2-yl]ethynyl-trimethylsilane (PubChem CID 15649762) has the molecular formula C11H20OSi and a molecular weight of 196.37 g/mol. Its IUPAC name is 2-[(2R,3R)-3-butyloxiran-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3R)-3-butyloxiran-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 15649762 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-[(2R,3R)-3-butyloxiran-2-yl]ethynyl-trimethylsilane |
| SMILES | CCCC[C@H]1O[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H20OSi/c1-5-6-7-10-11(12-10)8-9-13(2,3)4/h10-11H,5-7H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | UZYNOXXLZWEHOJ-GHMZBOCLSA-N |
| XLogP | 2.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|