C10H18OSi — CID 15863615
trimethyl-[2-[(2R,3R)-3-propyloxiran-2-yl]ethynyl]silane (PubChem CID 15863615) has the molecular formula C10H18OSi and a molecular weight of 182.34 g/mol. Its IUPAC name is trimethyl-[2-[(2R,3R)-3-propyloxiran-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2R,3R)-3-propyloxiran-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 15863615 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | trimethyl-[2-[(2R,3R)-3-propyloxiran-2-yl]ethynyl]silane |
| SMILES | CCC[C@H]1O[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H18OSi/c1-5-6-9-10(11-9)7-8-12(2,3)4/h9-10H,5-6H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | JPMDSYQDXJHLIZ-NXEZZACHSA-N |
| XLogP | 2.43 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|