C24H30N4O5 — CID 156503808
9-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]-3-azaspiro[5.5]undecane-3-carboxylic acid (PubChem CID 156503808) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 9-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]-3-azaspiro[5.5]undecane-3-carboxylic acid.
| Compound Name | 9-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]-3-azaspiro[5.5]undecane-3-carboxylic acid |
|---|---|
| PubChem CID | 156503808 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 9-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-4-yl]-3-azaspiro[5.5]undecane-3-carboxylic acid |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(C3CCC4(CC3)CCN(C(=O)O)CC4)c21 |
| InChI | InChI=1S/C24H30N4O5/c1-26-20-16(15-7-9-24(10-8-15)11-13-27(14-12-24)23(32)33)3-2-4-17(20)28(22(26)31)18-5-6-19(29)25-21(18)30/h2-4,15,18H,5-14H2,1H3,(H,32,33)(H,25,29,30) |
| InChIKey | BNJNCYPDASEKRW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|