C14H16F2N2O5 — CID 156505979
2-[1-[2-(difluoromethyl)-4-nitrophenyl]-4-hydroxypiperidin-4-yl]acetic acid (PubChem CID 156505979) has the molecular formula C14H16F2N2O5 and a molecular weight of 330.29 g/mol. Its IUPAC name is 2-[1-[2-(difluoromethyl)-4-nitrophenyl]-4-hydroxypiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[2-(difluoromethyl)-4-nitrophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 156505979 |
| Molecular Formula | C14H16F2N2O5 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[1-[2-(difluoromethyl)-4-nitrophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCN(c2ccc([N+](=O)[O-])cc2C(F)F)CC1 |
| InChI | InChI=1S/C14H16F2N2O5/c15-13(16)10-7-9(18(22)23)1-2-11(10)17-5-3-14(21,4-6-17)8-12(19)20/h1-2,7,13,21H,3-6,8H2,(H,19,20) |
| InChIKey | KHCFYUJLQZHOSL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|