C7H7F2N3O2S — CID 156507566
N'-(2,2-difluoroacetyl)-5-methyl-1,3-thiazole-2-carbohydrazide (PubChem CID 156507566) has the molecular formula C7H7F2N3O2S and a molecular weight of 235.22 g/mol. Its IUPAC name is N'-(2,2-difluoroacetyl)-5-methyl-1,3-thiazole-2-carbohydrazide.
| Compound Name | N'-(2,2-difluoroacetyl)-5-methyl-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 156507566 |
| Molecular Formula | C7H7F2N3O2S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | N'-(2,2-difluoroacetyl)-5-methyl-1,3-thiazole-2-carbohydrazide |
| SMILES | Cc1cnc(C(=O)NNC(=O)C(F)F)s1 |
| InChI | InChI=1S/C7H7F2N3O2S/c1-3-2-10-7(15-3)6(14)12-11-5(13)4(8)9/h2,4H,1H3,(H,11,13)(H,12,14) |
| InChIKey | CBOLAPWXBGXMFB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|