C5H6N2OS — CID 22367510
5-methyl-1,3-thiazole-2-carboxamide (PubChem CID 22367510) has the molecular formula C5H6N2OS and a molecular weight of 142.18 g/mol. Its IUPAC name is 5-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | 5-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 22367510 |
| Molecular Formula | C5H6N2OS |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | 5-methyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cnc(C(N)=O)s1 |
| InChI | InChI=1S/C5H6N2OS/c1-3-2-7-5(9-3)4(6)8/h2H,1H3,(H2,6,8) |
| InChIKey | WDAJTSIOZWNSIZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |