C5H3N3OS — CID 69293559
5-cyano-1,3-thiazole-2-carboxamide (PubChem CID 69293559) has the molecular formula C5H3N3OS and a molecular weight of 153.17 g/mol. Its IUPAC name is 5-cyano-1,3-thiazole-2-carboxamide.
| Compound Name | 5-cyano-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 69293559 |
| Molecular Formula | C5H3N3OS |
| Molecular Weight | 153.17 g/mol |
| Exact Mass | 153.00 |
| IUPAC Name | 5-cyano-1,3-thiazole-2-carboxamide |
| SMILES | N#Cc1cnc(C(N)=O)s1 |
| InChI | InChI=1S/C5H3N3OS/c6-1-3-2-8-5(10-3)4(7)9/h2H,(H2,7,9) |
| InChIKey | MNTKMRXVIYWFKV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 79.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |