C6H6FNOS — CID 84764106
1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 84764106) has the molecular formula C6H6FNOS and a molecular weight of 159.18 g/mol. Its IUPAC name is 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 84764106 |
| Molecular Formula | C6H6FNOS |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | CC(=O)c1ncc(CF)s1 |
| InChI | InChI=1S/C6H6FNOS/c1-4(9)6-8-3-5(2-7)10-6/h3H,2H2,1H3 |
| InChIKey | CKDXGMUCSXJEGK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |