C24H27Cl2FN4O4 — CID 156508182
2-[[4-[(2-amino-2-iminoethoxy)-phenoxymethyl]-3-fluorophenyl]-phenoxymethoxy]ethanimidamide;dihydrochloride (PubChem CID 156508182) has the molecular formula C24H27Cl2FN4O4 and a molecular weight of 525.41 g/mol. Its IUPAC name is 2-[[4-[(2-amino-2-iminoethoxy)-phenoxymethyl]-3-fluorophenyl]-phenoxymethoxy]ethanimidamide;dihydrochloride.
| Compound Name | 2-[[4-[(2-amino-2-iminoethoxy)-phenoxymethyl]-3-fluorophenyl]-phenoxymethoxy]ethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 156508182 |
| Molecular Formula | C24H27Cl2FN4O4 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[[4-[(2-amino-2-iminoethoxy)-phenoxymethyl]-3-fluorophenyl]-phenoxymethoxy]ethanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)COC(Oc1ccccc1)c1ccc(C(OC/C(N)=N/[H])Oc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H25FN4O4.2ClH/c25-20-13-16(23(30-14-21(26)27)32-17-7-3-1-4-8-17)11-12-19(20)24(31-15-22(28)29)33-18-9-5-2-6-10-18;;/h1-13,23-24H,14-15H2,(H3,26,27)(H3,28,29);2*1H |
| InChIKey | YZMKZBWDUUVGFV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|