C14H24N2O2 — CID 156508537
2-(tert-butylamino)-1-(6-propan-2-yl-2-pyridinyl)ethane-1,1-diol (PubChem CID 156508537) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(6-propan-2-yl-2-pyridinyl)ethane-1,1-diol.
| Compound Name | 2-(tert-butylamino)-1-(6-propan-2-yl-2-pyridinyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 156508537 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-(tert-butylamino)-1-(6-propan-2-yl-2-pyridinyl)ethane-1,1-diol |
| SMILES | CC(C)c1cccc(C(O)(O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C14H24N2O2/c1-10(2)11-7-6-8-12(16-11)14(17,18)9-15-13(3,4)5/h6-8,10,15,17-18H,9H2,1-5H3 |
| InChIKey | YUZVEOGISXPNLO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|