C14H24N2O2 — CID 170592947
(2S)-1-(tert-butylamino)-2-(6-ethoxy-2-pyridinyl)propan-2-ol (PubChem CID 170592947) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S)-1-(tert-butylamino)-2-(6-ethoxy-2-pyridinyl)propan-2-ol.
| Compound Name | (2S)-1-(tert-butylamino)-2-(6-ethoxy-2-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 170592947 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2S)-1-(tert-butylamino)-2-(6-ethoxy-2-pyridinyl)propan-2-ol |
| SMILES | CCOc1cccc([C@@](C)(O)CNC(C)(C)C)n1 |
| InChI | InChI=1S/C14H24N2O2/c1-6-18-12-9-7-8-11(16-12)14(5,17)10-15-13(2,3)4/h7-9,15,17H,6,10H2,1-5H3/t14-/m0/s1 |
| InChIKey | JCPYXKSQAYSGDC-AWEZNQCLSA-N |
| XLogP | 2.08 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |