C12H23N2O5S+ — CID 156509272
2-hydroxy-3-[1-methyl-4-(2-methylprop-2-enoyl)piperazin-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 156509272) has the molecular formula C12H23N2O5S+ and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-hydroxy-3-[1-methyl-4-(2-methylprop-2-enoyl)piperazin-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 2-hydroxy-3-[1-methyl-4-(2-methylprop-2-enoyl)piperazin-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 156509272 |
| Molecular Formula | C12H23N2O5S+ |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-hydroxy-3-[1-methyl-4-(2-methylprop-2-enoyl)piperazin-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)N1CC[N+](C)(CC(O)CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H22N2O5S/c1-10(2)12(16)13-4-6-14(3,7-5-13)8-11(15)9-20(17,18)19/h11,15H,1,4-9H2,2-3H3/p+1 |
| InChIKey | CAWPLRBSDYXUTE-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|