C8H18NO5S+ — CID 59019127
2-hydroxy-3-(4-methylmorpholin-4-ium-4-yl)propane-1-sulfonic acid (PubChem CID 59019127) has the molecular formula C8H18NO5S+ and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-hydroxy-3-(4-methylmorpholin-4-ium-4-yl)propane-1-sulfonic acid.
| Compound Name | 2-hydroxy-3-(4-methylmorpholin-4-ium-4-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59019127 |
| Molecular Formula | C8H18NO5S+ |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-hydroxy-3-(4-methylmorpholin-4-ium-4-yl)propane-1-sulfonic acid |
| SMILES | C[N+]1(CC(O)CS(=O)(=O)O)CCOCC1 |
| InChI | InChI=1S/C8H17NO5S/c1-9(2-4-14-5-3-9)6-8(10)7-15(11,12)13/h8,10H,2-7H2,1H3/p+1 |
| InChIKey | ZUIKQZBGRARDEO-UHFFFAOYSA-O |
| XLogP | -1.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|