C57H66N12O15 — CID 156513948
CID 156513948 (PubChem CID 156513948) has the molecular formula C57H66N12O15 and a molecular weight of 1159.22 g/mol.
| Compound Name | CID 156513948 |
|---|---|
| PubChem CID | 156513948 |
| Molecular Formula | C57H66N12O15 |
| Molecular Weight | 1159.22 g/mol |
| Exact Mass | 1158.48 |
| IUPAC Name | — |
| SMILES | COCCN1CC(=O)N2C[C@]3(C[C@H]2C(=O)N(CCOC)CC(=O)N2C[C@]4(C[C@H]2C(=O)N(CCOC)CC(=O)N2C[C@]5(C[C@H]2C1=O)NC(=O)N(Cc1ccccc1)C5=O)NC(=O)N(Cc1ccccc1)C4=O)NC(=O)N(Cc1ccccc1)C3=O |
| InChI | InChI=1S/C57H66N12O15/c1-82-22-19-61-31-43(70)68-35-56(50(77)65(53(80)59-56)29-38-15-9-5-10-16-38)26-41(68)47(74)63(21-24-84-3)33-45(72)69-36-57(51(78)66(54(81)60-57)30-39-17-11-6-12-18-39)27-42(69)48(75)62(20-23-83-2)32-44(71)67-34-55(25-40(67)46(61)73)49(76)64(52(79)58-55)28-37-13-7-4-8-14-37/h4-18,40-42H,19-36H2,1-3H3,(H,58,79)(H,59,80)(H,60,81)/t40-,41-,42-,55-,56-,57-/m0/s1 |
| InChIKey | IORWYQFFLGYWNR-JDPYODJYSA-N |
| XLogP | -1.30 |
| TPSA | 297.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1159.22 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|