C27H26ClF4N5O2S — CID 156520147
12-amino-8-(3-chloro-4-fluorophenyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 156520147) has the molecular formula C27H26ClF4N5O2S and a molecular weight of 596.05 g/mol. Its IUPAC name is 12-amino-8-(3-chloro-4-fluorophenyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 12-amino-8-(3-chloro-4-fluorophenyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 156520147 |
| Molecular Formula | C27H26ClF4N5O2S |
| Molecular Weight | 596.05 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | 12-amino-8-(3-chloro-4-fluorophenyl)-4-[(3R,5S)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)c(Cl)c5)c(C(F)(F)F)cc24)SCC(N)C3)C[C@@H]1C |
| InChI | InChI=1S/C27H26ClF4N5O2S/c1-4-21(38)37-13(2)9-35(10-14(37)3)25-17-8-18(27(30,31)32)22(15-5-6-20(29)19(28)7-15)24-23(17)36(26(39)34-25)11-16(33)12-40-24/h4-8,13-14,16H,1,9-12,33H2,2-3H3/t13-,14+,16? |
| InChIKey | ANEUAKFIJBMPAJ-MZBDJJRSSA-N |
| XLogP | 4.92 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.05 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|