C28H27ClF4N4O3S — CID 167115608
8-(3-chloro-4-fluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 167115608) has the molecular formula C28H27ClF4N4O3S and a molecular weight of 611.06 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 167115608 |
| Molecular Formula | C28H27ClF4N4O3S |
| Molecular Weight | 611.06 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-12-methoxy-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1C(C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)c(Cl)c5)c(C(F)(F)F)cc24)SCC(OC)C3)CC1C |
| InChI | InChI=1S/C28H27ClF4N4O3S/c1-5-22(38)37-14(2)10-35(11-15(37)3)26-18-9-19(28(31,32)33)23(16-6-7-21(30)20(29)8-16)25-24(18)36(27(39)34-26)12-17(40-4)13-41-25/h5-9,14-15,17H,1,10-13H2,2-4H3 |
| InChIKey | ORSXIKBPNJKWKT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.06 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|