C29H30ClF4N5O3S — CID 156520517
8-(3-chloro-4-fluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 156520517) has the molecular formula C29H30ClF4N5O3S and a molecular weight of 640.10 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 156520517 |
| Molecular Formula | C29H30ClF4N5O3S |
| Molecular Weight | 640.10 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-12-[2-(dimethylamino)ethoxy]-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)c(Cl)c5)c(C(F)(F)F)cc24)SCC(OCCN(C)C)C3)CC1 |
| InChI | InChI=1S/C29H30ClF4N5O3S/c1-4-23(40)37-7-9-38(10-8-37)27-19-14-20(29(32,33)34)24(17-5-6-22(31)21(30)13-17)26-25(19)39(28(41)35-27)15-18(16-43-26)42-12-11-36(2)3/h4-6,13-14,18H,1,7-12,15-16H2,2-3H3 |
| InChIKey | BQMUIHNVPOPCEW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.10 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|