C28H27ClF4N4O4S — CID 164541317
(12S)-8-(3-chloro-4-fluorophenyl)-12-(2-methoxyethoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 164541317) has the molecular formula C28H27ClF4N4O4S and a molecular weight of 627.06 g/mol. Its IUPAC name is (12S)-8-(3-chloro-4-fluorophenyl)-12-(2-methoxyethoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | (12S)-8-(3-chloro-4-fluorophenyl)-12-(2-methoxyethoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 164541317 |
| Molecular Formula | C28H27ClF4N4O4S |
| Molecular Weight | 627.06 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | (12S)-8-(3-chloro-4-fluorophenyl)-12-(2-methoxyethoxy)-4-(4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)c(Cl)c5)c(C(F)(F)F)cc24)SC[C@@H](OCCOC)C3)CC1 |
| InChI | InChI=1S/C28H27ClF4N4O4S/c1-3-22(38)35-6-8-36(9-7-35)26-18-13-19(28(31,32)33)23(16-4-5-21(30)20(29)12-16)25-24(18)37(27(39)34-26)14-17(15-42-25)41-11-10-40-2/h3-5,12-13,17H,1,6-11,14-15H2,2H3/t17-/m0/s1 |
| InChIKey | KQLCWWNVJGPRQL-KRWDZBQOSA-N |
| XLogP | 4.85 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.06 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|