C27H29F4N5O2S — CID 167115502
12-amino-8-(4-fluorophenyl)-4-[(3R,5S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 167115502) has the molecular formula C27H29F4N5O2S and a molecular weight of 563.62 g/mol. Its IUPAC name is 12-amino-8-(4-fluorophenyl)-4-[(3R,5S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 12-amino-8-(4-fluorophenyl)-4-[(3R,5S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 167115502 |
| Molecular Formula | C27H29F4N5O2S |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 12-amino-8-(4-fluorophenyl)-4-[(3R,5S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5)c(C(F)(F)F)cc24)SCC(N)C3)C[C@@H]1C |
| InChI | InChI=1S/C27H29F4N5O2S/c1-4-21(37)36-14(2)10-34(11-15(36)3)25-19-9-20(27(29,30)31)22(16-5-7-17(28)8-6-16)24-23(19)35(26(38)33-25)12-18(32)13-39-24/h4-9,14-15,18,21,37H,1,10-13,32H2,2-3H3/t14-,15+,18?,21? |
| InChIKey | JRMFZXKXKQSDOI-CHLRHJHGSA-N |
| XLogP | 4.06 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|