C27H26BrF5N4O2S — CID 167115602
8-(5-bromo-2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 167115602) has the molecular formula C27H26BrF5N4O2S and a molecular weight of 645.49 g/mol. Its IUPAC name is 8-(5-bromo-2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(5-bromo-2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 167115602 |
| Molecular Formula | C27H26BrF5N4O2S |
| Molecular Weight | 645.49 g/mol |
| Exact Mass | 644.09 |
| IUPAC Name | 8-(5-bromo-2,4-difluorophenyl)-4-[(3S)-4-(1-hydroxyprop-2-enyl)-3,5-dimethylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(O)N1C(C)CN(c2nc(=O)n3c4c(c(-c5cc(Br)c(F)cc5F)c(C(F)(F)F)cc24)SCCC3)C[C@@H]1C |
| InChI | InChI=1S/C27H26BrF5N4O2S/c1-4-21(38)37-13(2)11-35(12-14(37)3)25-16-8-17(27(31,32)33)22(15-9-18(28)20(30)10-19(15)29)24-23(16)36(26(39)34-25)6-5-7-40-24/h4,8-10,13-14,21,38H,1,5-7,11-12H2,2-3H3/t13-,14?,21?/m0/s1 |
| InChIKey | GIKCTTZCYWSFDN-FHDQPZTMSA-N |
| XLogP | 6.02 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|