C24H22BrF5N4OS — CID 164541836
8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 164541836) has the molecular formula C24H22BrF5N4OS and a molecular weight of 589.43 g/mol. Its IUPAC name is 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 164541836 |
| Molecular Formula | C24H22BrF5N4OS |
| Molecular Weight | 589.43 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | CC1CN(c2nc(=O)n3c4c(c(-c5cc(Br)c(F)cc5F)c(C(F)(F)F)cc24)SCCC3)CC(C)N1 |
| InChI | InChI=1S/C24H22BrF5N4OS/c1-11-9-33(10-12(2)31-11)22-14-6-15(24(28,29)30)19(13-7-16(25)18(27)8-17(13)26)21-20(14)34(23(35)32-22)4-3-5-36-21/h6-8,11-12,31H,3-5,9-10H2,1-2H3 |
| InChIKey | PQGFZHLIODYZEI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|