C27H24BrF5N4O2S — CID 164541730
8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 164541730) has the molecular formula C27H24BrF5N4O2S and a molecular weight of 643.48 g/mol. Its IUPAC name is 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 164541730 |
| Molecular Formula | C27H24BrF5N4O2S |
| Molecular Weight | 643.48 g/mol |
| Exact Mass | 642.07 |
| IUPAC Name | 8-(5-bromo-2,4-difluorophenyl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C=CC(=O)N1C(C)CN(c2nc(=O)n3c4c(c(-c5cc(Br)c(F)cc5F)c(C(F)(F)F)cc24)SCCC3)CC1C |
| InChI | InChI=1S/C27H24BrF5N4O2S/c1-4-21(38)37-13(2)11-35(12-14(37)3)25-16-8-17(27(31,32)33)22(15-9-18(28)20(30)10-19(15)29)24-23(16)36(26(39)34-25)6-5-7-40-24/h4,8-10,13-14H,1,5-7,11-12H2,2-3H3 |
| InChIKey | GLJXPUABGHPMIS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|