C29H30ClF5N4O3S — CID 167115521
tert-butyl 4-[8-(5-chloro-2,4-difluorophenyl)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 167115521) has the molecular formula C29H30ClF5N4O3S and a molecular weight of 645.09 g/mol. Its IUPAC name is tert-butyl 4-[8-(5-chloro-2,4-difluorophenyl)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-(5-chloro-2,4-difluorophenyl)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 167115521 |
| Molecular Formula | C29H30ClF5N4O3S |
| Molecular Weight | 645.09 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | tert-butyl 4-[8-(5-chloro-2,4-difluorophenyl)-2-oxo-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-4-yl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2nc(=O)n3c4c(c(-c5cc(Cl)c(F)cc5F)c(C(F)(F)F)cc24)SCCC3)CC(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H30ClF5N4O3S/c1-14-12-37(13-15(2)39(14)27(41)42-28(3,4)5)25-17-9-18(29(33,34)35)22(16-10-19(30)21(32)11-20(16)31)24-23(17)38(26(40)36-25)7-6-8-43-24/h9-11,14-15H,6-8,12-13H2,1-5H3 |
| InChIKey | HFGJOIYANLBPJZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.09 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|