C23H21F5N4OS — CID 156520045
8-(2,4-difluorophenyl)-4-[(2S)-2-methylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one (PubChem CID 156520045) has the molecular formula C23H21F5N4OS and a molecular weight of 496.51 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-4-[(2S)-2-methylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one.
| Compound Name | 8-(2,4-difluorophenyl)-4-[(2S)-2-methylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
|---|---|
| PubChem CID | 156520045 |
| Molecular Formula | C23H21F5N4OS |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 8-(2,4-difluorophenyl)-4-[(2S)-2-methylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraen-2-one |
| SMILES | C[C@H]1CNCCN1c1nc(=O)n2c3c(c(-c4ccc(F)cc4F)c(C(F)(F)F)cc13)SCCC2 |
| InChI | InChI=1S/C23H21F5N4OS/c1-12-11-29-5-7-31(12)21-15-10-16(23(26,27)28)18(14-4-3-13(24)9-17(14)25)20-19(15)32(22(33)30-21)6-2-8-34-20/h3-4,9-10,12,29H,2,5-8,11H2,1H3/t12-/m0/s1 |
| InChIKey | KDMNZLLXJVWZTK-LBPRGKRZSA-N |
| XLogP | 4.65 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |