About ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate
ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate (PubChem CID 156523807) has the molecular formula C11H11Cl3N2O4S
and a molecular weight of 373.65 g/mol. Its IUPAC name is ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate.
Molecular Properties
| Compound Name | ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate |
| PubChem CID | 156523807 |
| Molecular Formula | C11H11Cl3N2O4S |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)C(CC(N)=O)NC(=O)c1sc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl3N2O4S/c1-2-20-11(19)4(3-5(15)17)16-10(18)8-6(12)7(13)9(14)21-8/h4H,2-3H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | DBRBDYZZTINBBF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate?
The IUPAC name of ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate (CID 156523807) is ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate.
What is the SMILES notation for ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate?
The canonical SMILES for ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate is CCOC(=O)C(CC(N)=O)NC(=O)c1sc(Cl)c(Cl)c1Cl.
What is the InChIKey of ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate?
The InChIKey is DBRBDYZZTINBBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl3N2O4S/c1-2-20-11(19)4(3-5(15)17)16-10(18)8-6(12)7(13)9(14)21-8/h4H,2-3H2,1H3,(H2,15,17)(H,16,18).
What are the key properties of ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate?
ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate has a molecular weight of 373.65 g/mol, XLogP of 2.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-amino-4-oxo-2-[(3,4,5-trichlorothiophene-2-carbonyl)amino]butanoate is sourced from PubChem (CID 156523807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).