C41H50N4O9 — CID 156523949
2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]-3-methylperoxycyclobuta-1,3-dien-1-ol (PubChem CID 156523949) has the molecular formula C41H50N4O9 and a molecular weight of 742.87 g/mol. Its IUPAC name is 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]-3-methylperoxycyclobuta-1,3-dien-1-ol.
| Compound Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]-3-methylperoxycyclobuta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 156523949 |
| Molecular Formula | C41H50N4O9 |
| Molecular Weight | 742.87 g/mol |
| Exact Mass | 742.36 |
| IUPAC Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-[(E)-2-pyridin-4-ylethenyl]pyrrol-2-yl]-3-methylperoxycyclobuta-1,3-dien-1-ol |
| SMILES | COCCOCCOCCn1c(/C=C/c2ccncc2)ccc1C1=C(O)C(c2ccc(/C=C/c3ccncc3)n2CCOCCOCCOC)=C1OOC |
| InChI | InChI=1S/C41H50N4O9/c1-47-24-26-52-30-28-50-22-20-44-34(6-4-32-12-16-42-17-13-32)8-10-36(44)38-40(46)39(41(38)54-49-3)37-11-9-35(7-5-33-14-18-43-19-15-33)45(37)21-23-51-29-31-53-27-25-48-2/h4-19,46H,20-31H2,1-3H3/b6-4+,7-5+ |
| InChIKey | AXQNQUCWNRAMCP-YDFGWWAZSA-N |
| XLogP | 6.05 |
| TPSA | 129.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|