C40H54N4O8-2 — CID 158113031
2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-(2-pyridin-4-ylethyl)pyrrol-2-yl]cyclobutane-1,3-diolate (PubChem CID 158113031) has the molecular formula C40H54N4O8-2 and a molecular weight of 718.89 g/mol. Its IUPAC name is 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-(2-pyridin-4-ylethyl)pyrrol-2-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-(2-pyridin-4-ylethyl)pyrrol-2-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 158113031 |
| Molecular Formula | C40H54N4O8-2 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | 2,4-bis[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5-(2-pyridin-4-ylethyl)pyrrol-2-yl]cyclobutane-1,3-diolate |
| SMILES | COCCOCCOCCn1c(CCc2ccncc2)ccc1C1C([O-])C(c2ccc(CCc3ccncc3)n2CCOCCOCCOC)C1[O-] |
| InChI | InChI=1S/C40H54N4O8/c1-47-23-25-51-29-27-49-21-19-43-33(5-3-31-11-15-41-16-12-31)7-9-35(43)37-39(45)38(40(37)46)36-10-8-34(6-4-32-13-17-42-18-14-32)44(36)20-22-50-28-30-52-26-24-48-2/h7-18,37-40H,3-6,19-30H2,1-2H3/q-2 |
| InChIKey | DKFIDRZMTTXCQG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 137.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|