C38H52N2O6-2 — CID 58615776
2,4-bis[1-[2-(2-butoxyethoxy)ethyl]-2-methylindol-3-yl]cyclobutane-1,3-diolate (PubChem CID 58615776) has the molecular formula C38H52N2O6-2 and a molecular weight of 632.84 g/mol. Its IUPAC name is 2,4-bis[1-[2-(2-butoxyethoxy)ethyl]-2-methylindol-3-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[1-[2-(2-butoxyethoxy)ethyl]-2-methylindol-3-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 58615776 |
| Molecular Formula | C38H52N2O6-2 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.38 |
| IUPAC Name | 2,4-bis[1-[2-(2-butoxyethoxy)ethyl]-2-methylindol-3-yl]cyclobutane-1,3-diolate |
| SMILES | CCCCOCCOCCn1c(C)c(C2C([O-])C(c3c(C)n(CCOCCOCCCC)c4ccccc34)C2[O-])c2ccccc21 |
| InChI | InChI=1S/C38H52N2O6/c1-5-7-19-43-23-25-45-21-17-39-27(3)33(29-13-9-11-15-31(29)39)35-37(41)36(38(35)42)34-28(4)40(32-16-12-10-14-30(32)34)18-22-46-26-24-44-20-8-6-2/h9-16,35-38H,5-8,17-26H2,1-4H3/q-2 |
| InChIKey | TWJCBOWWPGKASX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|