C11H11BrN2O2 — CID 156526127
methyl 4-bromo-1,5-dimethylindazole-3-carboxylate (PubChem CID 156526127) has the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. Its IUPAC name is methyl 4-bromo-1,5-dimethylindazole-3-carboxylate.
| Compound Name | methyl 4-bromo-1,5-dimethylindazole-3-carboxylate |
|---|---|
| PubChem CID | 156526127 |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | methyl 4-bromo-1,5-dimethylindazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c2ccc(C)c(Br)c12 |
| InChI | InChI=1S/C11H11BrN2O2/c1-6-4-5-7-8(9(6)12)10(11(15)16-3)13-14(7)2/h4-5H,1-3H3 |
| InChIKey | PWMJMMXFXNBJLB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |