C15H19ClN4O3 — CID 156527371
6-chloro-4-[(3S,4R)-3-ethoxy-4-hydroxypiperidin-1-yl]-1-methylpyrido[3,2-d]pyrimidin-2-one (PubChem CID 156527371) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 6-chloro-4-[(3S,4R)-3-ethoxy-4-hydroxypiperidin-1-yl]-1-methylpyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 6-chloro-4-[(3S,4R)-3-ethoxy-4-hydroxypiperidin-1-yl]-1-methylpyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 156527371 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 6-chloro-4-[(3S,4R)-3-ethoxy-4-hydroxypiperidin-1-yl]-1-methylpyrido[3,2-d]pyrimidin-2-one |
| SMILES | CCO[C@H]1CN(c2nc(=O)n(C)c3ccc(Cl)nc23)CC[C@H]1O |
| InChI | InChI=1S/C15H19ClN4O3/c1-3-23-11-8-20(7-6-10(11)21)14-13-9(4-5-12(16)17-13)19(2)15(22)18-14/h4-5,10-11,21H,3,6-8H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | GAHMUGLMMSEHSP-MNOVXSKESA-N |
| XLogP | 0.96 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|