C20H21F3N6O3 — CID 170292267
6-hydrazinyl-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrido[3,2-d]pyrimidin-2-one (PubChem CID 170292267) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 6-hydrazinyl-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrido[3,2-d]pyrimidin-2-one.
| Compound Name | 6-hydrazinyl-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrido[3,2-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 170292267 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 6-hydrazinyl-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]pyrido[3,2-d]pyrimidin-2-one |
| SMILES | Cn1c(=O)nc(N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)c2nc(NN)ccc21 |
| InChI | InChI=1S/C20H21F3N6O3/c1-28-15-6-7-16(27-24)25-17(15)18(26-19(28)30)29-10-8-13(9-11-29)31-12-2-4-14(5-3-12)32-20(21,22)23/h2-7,13H,8-11,24H2,1H3,(H,25,27) |
| InChIKey | DIRIETBQLVIDLK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|