C22H18BrF3N4O3 — CID 159992900
3-bromo-6-isocyano-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one (PubChem CID 159992900) has the molecular formula C22H18BrF3N4O3 and a molecular weight of 523.31 g/mol. Its IUPAC name is 3-bromo-6-isocyano-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one.
| Compound Name | 3-bromo-6-isocyano-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 159992900 |
| Molecular Formula | C22H18BrF3N4O3 |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | 3-bromo-6-isocyano-1-methyl-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CCC(Oc3ccc(OC(F)(F)F)cc3)CC1)c(Br)c(=O)n2C |
| InChI | InChI=1S/C22H18BrF3N4O3/c1-27-17-8-7-16-19(28-17)20(18(23)21(31)29(16)2)30-11-9-14(10-12-30)32-13-3-5-15(6-4-13)33-22(24,25)26/h3-8,14H,9-12H2,2H3 |
| InChIKey | OHECJYYXSOYZDL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|