C22H22N6O4 — CID 159077698
4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-6-isocyano-1-methyl-3-nitro-1,5-naphthyridin-2-one (PubChem CID 159077698) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-6-isocyano-1-methyl-3-nitro-1,5-naphthyridin-2-one.
| Compound Name | 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-6-isocyano-1-methyl-3-nitro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 159077698 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-6-isocyano-1-methyl-3-nitro-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CCN(C(CO)c3ccccc3)CC1)c([N+](=O)[O-])c(=O)n2C |
| InChI | InChI=1S/C22H22N6O4/c1-23-18-9-8-16-19(24-18)20(21(28(31)32)22(30)25(16)2)27-12-10-26(11-13-27)17(14-29)15-6-4-3-5-7-15/h3-9,17,29H,10-14H2,2H3 |
| InChIKey | KALNWKMSEKPXIP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|