C21H23N5O4 — CID 175508039
4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one (PubChem CID 175508039) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one.
| Compound Name | 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 175508039 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-[4-(2-hydroxy-1-phenylethyl)piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(N2CCN(C(CO)c3ccccc3)CC2)c2ncccc21 |
| InChI | InChI=1S/C21H23N5O4/c1-23-16-8-5-9-22-18(16)19(20(21(23)28)26(29)30)25-12-10-24(11-13-25)17(14-27)15-6-3-2-4-7-15/h2-9,17,27H,10-14H2,1H3 |
| InChIKey | XPTXQUCEKIJAPL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|