C27H25BrFN5O4 — CID 151052297
6-bromo-4-[4-[(2-fluoro-4-methylphenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one (PubChem CID 151052297) has the molecular formula C27H25BrFN5O4 and a molecular weight of 582.43 g/mol. Its IUPAC name is 6-bromo-4-[4-[(2-fluoro-4-methylphenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one.
| Compound Name | 6-bromo-4-[4-[(2-fluoro-4-methylphenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 151052297 |
| Molecular Formula | C27H25BrFN5O4 |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 6-bromo-4-[4-[(2-fluoro-4-methylphenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-1-methyl-3-nitro-1,5-naphthyridin-2-one |
| SMILES | Cc1ccc(C(c2ccccc2O)N2CCN(c3c([N+](=O)[O-])c(=O)n(C)c4ccc(Br)nc34)CC2)c(F)c1 |
| InChI | InChI=1S/C27H25BrFN5O4/c1-16-7-8-17(19(29)15-16)24(18-5-3-4-6-21(18)35)32-11-13-33(14-12-32)25-23-20(9-10-22(28)30-23)31(2)27(36)26(25)34(37)38/h3-10,15,24,35H,11-14H2,1-2H3 |
| InChIKey | MEJPLHUPXAWJOX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|