C29H24F2N6O5 — CID 153472719
methyl 1-[bis(4-fluorophenyl)methyl]-4-(6-isocyano-1-methyl-3-nitro-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxylate (PubChem CID 153472719) has the molecular formula C29H24F2N6O5 and a molecular weight of 574.54 g/mol. Its IUPAC name is methyl 1-[bis(4-fluorophenyl)methyl]-4-(6-isocyano-1-methyl-3-nitro-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxylate.
| Compound Name | methyl 1-[bis(4-fluorophenyl)methyl]-4-(6-isocyano-1-methyl-3-nitro-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 153472719 |
| Molecular Formula | C29H24F2N6O5 |
| Molecular Weight | 574.54 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | methyl 1-[bis(4-fluorophenyl)methyl]-4-(6-isocyano-1-methyl-3-nitro-2-oxo-1,5-naphthyridin-4-yl)piperazine-2-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)C(C(=O)OC)C1)c([N+](=O)[O-])c(=O)n2C |
| InChI | InChI=1S/C29H24F2N6O5/c1-32-23-13-12-21-24(33-23)26(27(37(40)41)28(38)34(21)2)35-14-15-36(22(16-35)29(39)42-3)25(17-4-8-19(30)9-5-17)18-6-10-20(31)11-7-18/h4-13,22,25H,14-16H2,2-3H3 |
| InChIKey | URTBAMODNVTYDB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|