C31H32F2N6O5 — CID 170172884
[8-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridin-2-yl]-tert-butylcarbamic acid (PubChem CID 170172884) has the molecular formula C31H32F2N6O5 and a molecular weight of 606.63 g/mol. Its IUPAC name is [8-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridin-2-yl]-tert-butylcarbamic acid.
| Compound Name | [8-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridin-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 170172884 |
| Molecular Formula | C31H32F2N6O5 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | [8-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridin-2-yl]-tert-butylcarbamic acid |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)c2nc(N(C(=O)O)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C31H32F2N6O5/c1-31(2,3)38(30(41)42)24-14-13-23-25(34-24)27(28(39(43)44)29(40)35(23)4)37-17-15-36(16-18-37)26(19-5-9-21(32)10-6-19)20-7-11-22(33)12-8-20/h5-14,26H,15-18H2,1-4H3,(H,41,42) |
| InChIKey | YHHCHACMOHZNOH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|