C22H21FN6O3 — CID 171034212
8-[4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 171034212) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is 8-[4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171034212 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 8-[4-[(1S)-1-(4-fluorophenyl)ethyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | C[C@@H](c1ccc(F)cc1)N1CCN(c2c([N+](=O)[O-])c(=O)n(C)c3ccc(C#N)nc23)CC1 |
| InChI | InChI=1S/C22H21FN6O3/c1-14(15-3-5-16(23)6-4-15)27-9-11-28(12-10-27)20-19-18(8-7-17(13-24)25-19)26(2)22(30)21(20)29(31)32/h3-8,14H,9-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | FRPRHNFLVFLCNB-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 108.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|