C28H25FN6O4 — CID 171034201
8-[4-[(R)-(4-fluorophenyl)-(2-methoxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 171034201) has the molecular formula C28H25FN6O4 and a molecular weight of 528.54 g/mol. Its IUPAC name is 8-[4-[(R)-(4-fluorophenyl)-(2-methoxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[4-[(R)-(4-fluorophenyl)-(2-methoxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171034201 |
| Molecular Formula | C28H25FN6O4 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 8-[4-[(R)-(4-fluorophenyl)-(2-methoxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | COc1ccccc1[C@@H](c1ccc(F)cc1)N1CCN(c2c([N+](=O)[O-])c(=O)n(C)c3ccc(C#N)nc23)CC1 |
| InChI | InChI=1S/C28H25FN6O4/c1-32-22-12-11-20(17-30)31-24(22)26(27(28(32)36)35(37)38)34-15-13-33(14-16-34)25(18-7-9-19(29)10-8-18)21-5-3-4-6-23(21)39-2/h3-12,25H,13-16H2,1-2H3/t25-/m1/s1 |
| InChIKey | JHJVIENPHNMFNQ-RUZDIDTESA-N |
| XLogP | 3.77 |
| TPSA | 117.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|