C27H23FN6O4 — CID 171034228
8-[4-[(R)-(4-fluorophenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 171034228) has the molecular formula C27H23FN6O4 and a molecular weight of 514.52 g/mol. Its IUPAC name is 8-[4-[(R)-(4-fluorophenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[4-[(R)-(4-fluorophenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171034228 |
| Molecular Formula | C27H23FN6O4 |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 8-[4-[(R)-(4-fluorophenyl)-(2-hydroxyphenyl)methyl]piperazin-1-yl]-5-methyl-7-nitro-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | Cn1c(=O)c([N+](=O)[O-])c(N2CCN([C@H](c3ccc(F)cc3)c3ccccc3O)CC2)c2nc(C#N)ccc21 |
| InChI | InChI=1S/C27H23FN6O4/c1-31-21-11-10-19(16-29)30-23(21)25(26(27(31)36)34(37)38)33-14-12-32(13-15-33)24(17-6-8-18(28)9-7-17)20-4-2-3-5-22(20)35/h2-11,24,35H,12-15H2,1H3/t24-/m1/s1 |
| InChIKey | SXEFHRDGRYWIBW-XMMPIXPASA-N |
| XLogP | 3.47 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|