C32H30F2N6O3 — CID 170685615
(4R,7R)-5-[bis(4-fluorophenyl)methyl]-16-isocyano-9-(2-methoxyethyl)-4,12-dimethyl-2,5,9,12,17-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione (PubChem CID 170685615) has the molecular formula C32H30F2N6O3 and a molecular weight of 584.63 g/mol. Its IUPAC name is (4R,7R)-5-[bis(4-fluorophenyl)methyl]-16-isocyano-9-(2-methoxyethyl)-4,12-dimethyl-2,5,9,12,17-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione.
| Compound Name | (4R,7R)-5-[bis(4-fluorophenyl)methyl]-16-isocyano-9-(2-methoxyethyl)-4,12-dimethyl-2,5,9,12,17-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione |
|---|---|
| PubChem CID | 170685615 |
| Molecular Formula | C32H30F2N6O3 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | (4R,7R)-5-[bis(4-fluorophenyl)methyl]-16-isocyano-9-(2-methoxyethyl)-4,12-dimethyl-2,5,9,12,17-pentazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13(18),14,16-tetraene-8,11-dione |
| SMILES | [C-]#[N+]c1ccc2c(n1)c1c(c(=O)n2C)N(CCOC)C(=O)[C@H]2CN(C(c3ccc(F)cc3)c3ccc(F)cc3)[C@H](C)CN12 |
| InChI | InChI=1S/C32H30F2N6O3/c1-19-17-40-25(18-39(19)28(20-5-9-22(33)10-6-20)21-7-11-23(34)12-8-21)31(41)38(15-16-43-4)30-29(40)27-24(37(3)32(30)42)13-14-26(35-2)36-27/h5-14,19,25,28H,15-18H2,1,3-4H3/t19-,25-/m1/s1 |
| InChIKey | RAZOBCCJILOVKC-KBMIEXCESA-N |
| XLogP | 4.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|