C23H22F3N5O3 — CID 159620830
4-[(3S,4S)-3-ethoxy-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one (PubChem CID 159620830) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is 4-[(3S,4S)-3-ethoxy-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 4-[(3S,4S)-3-ethoxy-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 159620830 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-[(3S,4S)-3-ethoxy-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]piperidin-1-yl]-6-isocyano-1-methyl-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CC[C@H](Oc3cccc(C(F)(F)F)n3)[C@@H](OCC)C1)cc(=O)n2C |
| InChI | InChI=1S/C23H22F3N5O3/c1-4-33-17-13-31(11-10-16(17)34-20-7-5-6-18(28-20)23(24,25)26)15-12-21(32)30(3)14-8-9-19(27-2)29-22(14)15/h5-9,12,16-17H,4,10-11,13H2,1,3H3/t16-,17-/m0/s1 |
| InChIKey | MNWBNURYIKVDAL-IRXDYDNUSA-N |
| XLogP | 3.96 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|