C24H27N5O3 — CID 160573717
6-isocyano-1-methyl-4-[(3R,4S)-3-methyl-4-[(5-propan-2-yloxy-2-pyridinyl)oxy]piperidin-1-yl]-1,5-naphthyridin-2-one (PubChem CID 160573717) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-isocyano-1-methyl-4-[(3R,4S)-3-methyl-4-[(5-propan-2-yloxy-2-pyridinyl)oxy]piperidin-1-yl]-1,5-naphthyridin-2-one.
| Compound Name | 6-isocyano-1-methyl-4-[(3R,4S)-3-methyl-4-[(5-propan-2-yloxy-2-pyridinyl)oxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 160573717 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 6-isocyano-1-methyl-4-[(3R,4S)-3-methyl-4-[(5-propan-2-yloxy-2-pyridinyl)oxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1CC[C@H](Oc3ccc(OC(C)C)cn3)[C@H](C)C1)cc(=O)n2C |
| InChI | InChI=1S/C24H27N5O3/c1-15(2)31-17-6-9-22(26-13-17)32-20-10-11-29(14-16(20)3)19-12-23(30)28(5)18-7-8-21(25-4)27-24(18)19/h6-9,12-13,15-16,20H,10-11,14H2,1-3,5H3/t16-,20+/m1/s1 |
| InChIKey | RAWIZRKHUMRUMK-UZLBHIALSA-N |
| XLogP | 3.96 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|