C25H25F3N4O2 — CID 159336574
6-isocyano-1-methyl-4-[(2S,5S)-2,4,5-trimethyl-4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one (PubChem CID 159336574) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 6-isocyano-1-methyl-4-[(2S,5S)-2,4,5-trimethyl-4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one.
| Compound Name | 6-isocyano-1-methyl-4-[(2S,5S)-2,4,5-trimethyl-4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 159336574 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-isocyano-1-methyl-4-[(2S,5S)-2,4,5-trimethyl-4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]-1,5-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1ccc2c(n1)c(N1C[C@H](C)C(C)(Oc3cccc(C(F)(F)F)c3)C[C@@H]1C)cc(=O)n2C |
| InChI | InChI=1S/C25H25F3N4O2/c1-15-14-32(20-12-22(33)31(5)19-9-10-21(29-4)30-23(19)20)16(2)13-24(15,3)34-18-8-6-7-17(11-18)25(26,27)28/h6-12,15-16H,13-14H2,1-3,5H3/t15-,16-,24?/m0/s1 |
| InChIKey | LFPSEKSDCOQQRY-MXQSDKMXSA-N |
| XLogP | 5.58 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|