C14H14IN3O4 — CID 156528084
N-[2-(2-hydroxy-6-oxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]carbamoyl iodide (PubChem CID 156528084) has the molecular formula C14H14IN3O4 and a molecular weight of 415.19 g/mol. Its IUPAC name is N-[2-(2-hydroxy-6-oxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]carbamoyl iodide.
| Compound Name | N-[2-(2-hydroxy-6-oxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 156528084 |
| Molecular Formula | C14H14IN3O4 |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | N-[2-(2-hydroxy-6-oxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]carbamoyl iodide |
| SMILES | O=C(I)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1O)C2 |
| InChI | InChI=1S/C14H14IN3O4/c15-14(22)16-8-2-1-7-6-18(13(21)9(7)5-8)10-3-4-11(19)17-12(10)20/h1-2,5,10,12,20H,3-4,6H2,(H,16,22)(H,17,19) |
| InChIKey | AETZATJPSJZRFB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|