C13H14N2O3 — CID 146547624
2-[(3R)-2-hydroxy-6-oxopiperidin-3-yl]-3H-isoindol-1-one (PubChem CID 146547624) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-[(3R)-2-hydroxy-6-oxopiperidin-3-yl]-3H-isoindol-1-one.
| Compound Name | 2-[(3R)-2-hydroxy-6-oxopiperidin-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 146547624 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-[(3R)-2-hydroxy-6-oxopiperidin-3-yl]-3H-isoindol-1-one |
| SMILES | O=C1CC[C@@H](N2Cc3ccccc3C2=O)C(O)N1 |
| InChI | InChI=1S/C13H14N2O3/c16-11-6-5-10(12(17)14-11)15-7-8-3-1-2-4-9(8)13(15)18/h1-4,10,12,17H,5-7H2,(H,14,16)/t10-,12?/m1/s1 |
| InChIKey | ICFXLNXSCLYYTF-RWANSRKNSA-N |
| XLogP | 0.24 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |