C14H15ClN2O3 — CID 163626176
4-chloro-2-[(3S)-2-hydroxy-7-oxoazepan-3-yl]-3H-isoindol-1-one (PubChem CID 163626176) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-chloro-2-[(3S)-2-hydroxy-7-oxoazepan-3-yl]-3H-isoindol-1-one.
| Compound Name | 4-chloro-2-[(3S)-2-hydroxy-7-oxoazepan-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 163626176 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-chloro-2-[(3S)-2-hydroxy-7-oxoazepan-3-yl]-3H-isoindol-1-one |
| SMILES | O=C1CCC[C@H](N2Cc3c(Cl)cccc3C2=O)C(O)N1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-10-4-1-3-8-9(10)7-17(14(8)20)11-5-2-6-12(18)16-13(11)19/h1,3-4,11,13,19H,2,5-7H2,(H,16,18)/t11-,13?/m0/s1 |
| InChIKey | HSERMUZLAPKHOZ-AMGKYWFPSA-N |
| XLogP | 1.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |